论文部分内容阅读
A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben-zoic acid and 2,2’-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Cc, a = 14.0133(14), b = 16.0409(16), c = 30.372(3), β = 100.8950(10)o, V = 6704.1(12)3, Dc = 1.364 g/cm3, Z = 8, μ(MoKα) = 0.704 mm-1, F(000) = 2840, the final R = 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2’-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2’-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.
A new complex Cu2 (o-C6H5COC6H5COO) 4 (C10H8N2) 2 (H2O) 2 with 2-benzoylbenzoleic acid and 2,2’-bipyridine as ligands has been synthesized in mixed methanol and water solvent. a = 14.0133 (14), b = 16.0409 (16), c = 30.372 (3) β, β = 100.8950 (10) o, V = 6704.1 (12) 3, Dc = 1.364 g / The final R = 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2- benzoylbenzoic acid molecules, two 2,2’-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2’-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule , respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.